* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JH I |
| CAS: | 13804-51-8 |
| English Synonyms: | JH I |
| MDL Number.: | MFCD00221724 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC/C(=C\CC/C(=C/C(=O)OC)/C)/CC[C@H]1[C@@](O1)(C)CC |
| InChi: | InChI=1S/C18H30O3/c1-6-15(11-12-16-18(4,7-2)21-16)10-8-9-14(3)13-17(19)20-5/h10,13,16H,6-9,11-12H2,1-5H3/b14-13+,15-10+/t16-,18+/m0/s1 |
| InChiKey: | InChIKey=RQIDGZHMTWSMMC-IGTNHZALSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.