* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Hexanol, 6-(2-fluorophenoxy)- |
CAS: | 1383151-02-7 |
English Synonyms: | 1-HEXANOL, 6-(2-FLUOROPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(OCCCCCCO)C=CC=C1 |
InChi: | InChI=1S/C12H17FO2/c13-11-7-3-4-8-12(11)15-10-6-2-1-5-9-14/h3-4,7-8,14H,1-2,5-6,9-10H2 |
InChiKey: | InChIKey=GBLCWTMICAXCGQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.