* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (4R,5R)-2,2-DIETHYL-4,5-BIS(HYDROXYDI-3,5-XYLYLMETHYL)-1,3-DIOXOLANE |
| CAS: | 138710-29-9 |
| English Synonyms: | (4R,5R)-2,2-DIETHYL-4,5-BIS(HYDROXYDI-3,5-XYLYLMETHYL)-1,3-DIOXOLANE |
| MDL Number.: | MFCD16876595 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCC1(O[C@H]([C@@H](O1)C(c2cc(cc(c2)C)C)(c3cc(cc(c3)C)C)O)C(c4cc(cc(c4)C)C)(c5cc(cc(c5)C)C)O)CC |
| InChi: | InChI=1S/C41H50O4/c1-11-39(12-2)44-37(40(42,33-17-25(3)13-26(4)18-33)34-19-27(5)14-28(6)20-34)38(45-39)41(43,35-21-29(7)15-30(8)22-35)36-23-31(9)16-32(10)24-36/h13-24,37-38,42-43H,11-12H2,1-10H3/t37-,38-/m1/s1 |
| InChiKey: | InChIKey=UKBYGTDZHRFSPL-XPSQVAKYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.