* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-Phenylalanine, 3-bromo-2-chloro- |
CAS: | 1389851-07-3 |
English Synonyms: | D-PHENYLALANINE, 3-BROMO-2-CHLORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1C(=C(C[C@@H](N)C(=O)O)C=CC1)Cl |
InChi: | InChI=1S/C9H9BrClNO2/c10-6-3-1-2-5(8(6)11)4-7(12)9(13)14/h1-3,7H,4,12H2,(H,13,14)/t7-/m1/s1 |
InChiKey: | InChIKey=DVLUSRDTRABGCH-SSDOTTSWSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.