* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (3S)-4-CHLOROBUTANE-1,3-DIOL |
CAS: | 139013-68-6 |
English Synonyms: | (S)-4-CHLORO-1,3-BUTANEDIOL ; (3S)-4-CHLOROBUTANE-1,3-DIOL |
MDL Number.: | MFCD00798266 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C(CO)[C@@H](CCl)O |
InChi: | InChI=1S/C4H9ClO2/c5-3-4(7)1-2-6/h4,6-7H,1-3H2/t4-/m0/s1 |
InChiKey: | InChIKey=IQDXPPKWNPMHJI-BYPYZUCNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.