Molecular Structure:
CAS No.:
139180-30-6
Product Name.:
CCD No.:CCD00179708
Formula:C16 H15 N7 O2
MolWeight:337.341
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(16)
- Buyers(1)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | ZM 241385 |
| CAS： | 139180-30-6 |
| English Synonyms： | 4-(2-[7-AMINO-2-(2-FURYL)[1,2,4]TRIAZOLO[2,3-A][1,3,5]TRIAZIN-5-YLAMINO]ETHYL)PHENOL ; 4-(2-[[7-AMINO-2-(2-FURYL)[1,2,4]TRIAZOLO[1,5-A][1,3,5]TRIAZIN-5-YL]AMINO]ETHYL)PHENOL ; ZM 241385 ; 4-(2-(7-AMINO-2-(FURAN-2-YL)-[1,2,4]TRIAZOLO[1,5-A][1,3,5]TRIAZIN-5-YLAMINO)ETHYL)PHENOL |
| MDL Number.： | MFCD00908394 |
| H bond acceptor： | 9 |
| H bond donor： | 3 |
| Smile： | c1cc(oc1)c2nc3nc(nc(n3n2)N)NCCc4ccc(cc4)O |
| InChi： | InChI=1S/C16H15N7O2/c17-14-20-15(18-8-7-10-3-5-11(24)6-4-10)21-16-19-13(22-23(14)16)12-2-1-9-25-12/h1-6,9,24H,7-8H2,(H3,17,18,19,20,21,22) |
| InChiKey： | InChIKey=PWTBZOIUWZOPFT-UHFFFAOYSA-N |
|
|
|
|
| Symbol： |
GHS06
|
| Signal word： | Danger |
| Hazard statements： | H301 |
| Precautionary statements： | P301 + P310 |
| hazard symbol： | T |
| Risk Code： | R:25 |
| Safe Code： | S:46 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
