* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-Azido-1-octanamine HCl |
CAS: | 1392515-98-8 |
English Synonyms: | 8-AZIDO-1-OCTANAMINE HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.N(=[N+]=[N-])CCCCCCCCN |
InChi: | InChI=1S/C8H18N4.ClH/c9-7-5-3-1-2-4-6-8-11-12-10;/h1-9H2;1H |
InChiKey: | InChIKey=LKJKHQNHMCAXGT-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.