* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Propanoic acid, 3-(2-azidoethoxy)- |
CAS: | 1393330-34-1 |
English Synonyms: | PROPANOIC ACID, 3-(2-AZIDOETHOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCOCCC(=O)O |
InChi: | InChI=1S/C5H9N3O3/c6-8-7-2-4-11-3-1-5(9)10/h1-4H2,(H,9,10) |
InChiKey: | InChIKey=JKOVLUVEHHGAEW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.