* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,4-DICHLOROHEXANE |
| CAS: | 140237-59-8 ;140238-71-7 ;50635-35-3 ;140238-72-8 |
| English Synonyms: | HEXANE, 1,4-DICHLORO- ; 1,4-DICHLOROHEXANE |
| MDL Number.: | MFCD17012618 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCC(CCCCl)Cl |
| InChi: | InChI=1S/C6H12Cl2/c1-2-6(8)4-3-5-7/h6H,2-5H2,1H3 |
| InChiKey: | InChIKey=QUBRHRAWRVZUFZ-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.