Molecular Structure:
CAS No.:
50635-35-3
;140238-72-8
;140238-71-7
;140237-59-8
Product Name.:
CCD No.:CCD03284269
Formula:C6 H12 Cl2
MolWeight:155.067
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 1,4-DICHLOROHEXANE |
| CAS： | 50635-35-3 ;140238-72-8 ;140238-71-7 ;140237-59-8 |
| English Synonyms： | 1,4-DICHLOROHEXANE ; HEXANE, 1,4-DICHLORO- |
| MDL Number.： | MFCD17012618 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | CCC(CCCCl)Cl |
| InChi： | InChI=1S/C6H12Cl2/c1-2-6(8)4-3-5-7/h6H,2-5H2,1H3 |
| InChiKey： | InChIKey=QUBRHRAWRVZUFZ-UHFFFAOYSA-N |
|
|
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
