* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 8-Boc-2-fluoro-3-oxo-8-azabicyclo[3.2.1]octane |
CAS: | 1404196-37-7 |
English Synonyms: | 8-BOC-2-FLUORO-3-OXO-8-AZABICYCLO[3.2.1]OCTANE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N1C2C(C(CC1CC2)=O)F |
InChi: | InChI=1S/C12H18FNO3/c1-12(2,3)17-11(16)14-7-4-5-8(14)10(13)9(15)6-7/h7-8,10H,4-6H2,1-3H3 |
InChiKey: | InChIKey=YYCAGVRICFXYHB-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.