* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Hexanoic acid, 6-(3-ethoxyphenoxy)- |
CAS: | 1410085-49-2 |
English Synonyms: | HEXANOIC ACID, 6-(3-ETHOXYPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)OC=1C=C(OCCCCCC(=O)O)C=CC1 |
InChi: | InChI=1S/C14H20O4/c1-2-17-12-7-6-8-13(11-12)18-10-5-3-4-9-14(15)16/h6-8,11H,2-5,9-10H2,1H3,(H,15,16) |
InChiKey: | InChIKey=YBECNELROUEGJA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.