* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Ethyl 4-amino-3,5-difluorobenzoate |
CAS: | 1415920-00-1 |
English Synonyms: | ETHYL 4-AMINO-3,5-DIFLUOROBENZOATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC1=C(C=C(C(=O)OCC)C=C1F)F |
InChi: | InChI=1S/C9H9F2NO2/c1-2-14-9(13)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3 |
InChiKey: | InChIKey=MGZIYSCSHHUVHZ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.