* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4-NITRO-2,2'-BIPYRIDINE-N-OXIDE |
CAS: | 14163-00-9 |
English Synonyms: | 4-NITRO-2,2'-BIPYRIDINE-N-OXIDE |
MDL Number.: | MFCD00065174 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | c1ccnc(c1)c2cc(cc[n+]2[O-])[N+](=O)[O-] |
InChi: | InChI=1S/C10H7N3O3/c14-12-6-4-8(13(15)16)7-10(12)9-3-1-2-5-11-9/h1-7H |
InChiKey: | InChIKey=TXORGAZSDCKPSN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.