* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-((2-(tert-butoxy)-2-oxoethyl)amino)acetic acid |
CAS: | 141743-20-6 |
English Synonyms: | 2-((2-(TERT-BUTOXY)-2-OXOETHYL)AMINO)ACETIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)(C)(C)OC(CNCC(=O)O)=O |
InChi: | InChI=1S/C8H15NO4/c1-8(2,3)13-7(12)5-9-4-6(10)11/h9H,4-5H2,1-3H3,(H,10,11) |
InChiKey: | InChIKey=UVININLYSAHIFI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.