* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-Azido-nonanoic acid |
CAS: | 141779-77-3 |
English Synonyms: | 9-AZIDO-NONANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCCCCCCC(=O)O |
InChi: | InChI=1S/C9H17N3O2/c10-12-11-8-6-4-2-1-3-5-7-9(13)14/h1-8H2,(H,13,14) |
InChiKey: | InChIKey=CDKGQZWXTZZOCD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.