* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 13-Azido-tridecanoic acid |
CAS: | 141779-78-4 |
English Synonyms: | 13-AZIDO-TRIDECANOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCCCCCCCCCCC(=O)O |
InChi: | InChI=1S/C13H25N3O2/c14-16-15-12-10-8-6-4-2-1-3-5-7-9-11-13(17)18/h1-12H2,(H,17,18) |
InChiKey: | InChIKey=QGHYXKXWBVOVGJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.