* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,7-DIHYDRO-3-(4-FLUOROPHENYL)-1,2-BENZISOXAZOL-4(5H)-ONE |
| CAS: | 141926-83-2 |
| English Synonyms: | 6,7-DIHYDRO-3-(4-FLUOROPHENYL)-1,2-BENZISOXAZOL-4(5H)-ONE |
| MDL Number.: | MFCD17181479 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1c2c3c(on2)CCCC3=O)F |
| InChi: | InChI=1S/C13H10FNO2/c14-9-6-4-8(5-7-9)13-12-10(16)2-1-3-11(12)17-15-13/h4-7H,1-3H2 |
| InChiKey: | InChIKey=CLHBESKFHLDMHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.