* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GEX-1A |
| CAS: | 142861-00-5 |
| English Synonyms: | GEX-1A ; HERBOXYDIENE |
| MDL Number.: | MFCD09752733 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C[C@H]1CC[C@@H](O[C@@H]1/C(=C/C=C/[C@@H](C)C[C@]2([C@H](O2)[C@H](C)[C@H]([C@@H](C)O)OC)C)/C)CC(=O)O |
| InChi: | InChI=1S/C25H42O6/c1-15(14-25(6)24(31-25)18(4)23(29-7)19(5)26)9-8-10-16(2)22-17(3)11-12-20(30-22)13-21(27)28/h8-10,15,17-20,22-24,26H,11-14H2,1-7H3,(H,27,28)/b9-8+,16-10+/t15-,17+,18-,19-,20-,22-,23-,24-,25+/m1/s1 |
| InChiKey: | InChIKey=ISZXEMUWHQLLTC-HFAHVUFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.