* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(3-chlorophenyl)-6H-imidazo[5,1-b]thiazole-5-thione |
CAS: | 1429312-34-4 |
English Synonyms: | 3-(3-CHLOROPHENYL)-6H-IMIDAZO[5,1-B]THIAZOLE-5-THIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC=1C=C(C=CC1)C=1N2C(SC1)=CNC2=S |
InChi: | InChI=1S/C11H7ClN2S2/c12-8-3-1-2-7(4-8)9-6-16-10-5-13-11(15)14(9)10/h1-6H,(H,13,15) |
InChiKey: | InChIKey=BVZHBMNBBRHDJM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.