* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | FUROMINE |
CAS: | 142996-66-5 |
English Synonyms: | FUROMINE |
MDL Number.: | MFCD00868669 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(C(C(=O)C(O1)(C)C)[N+](=[CH-])CC[N+](=[CH-])C2C(=O)C(OC2(C)C)(C)C)C |
InChi: | InChI=1S/C20H32N2O4/c1-17(2)13(15(23)19(5,6)25-17)21(9)11-12-22(10)14-16(24)20(7,8)26-18(14,3)4/h9-10,13-14H,11-12H2,1-8H3 |
InChiKey: | InChIKey=MOSOWQIXTOYNDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.