* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,4,5,5-Tetramethyl-2-(4-(1,1,1-trifluoro-2-methylpropan-2-yl)phenyl)-1,3,2-dioxaborolane |
CAS: | 1432571-98-6 |
English Synonyms: | 4,4,5,5-TETRAMETHYL-2-(4-(1,1,1-TRIFLUORO-2-METHYLPROPAN-2-YL)PHENYL)-1,3,2-DIOXABOROLANE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1(OB(OC1(C)C)C1=CC=C(C=C1)C(C(F)(F)F)(C)C)C |
InChi: | InChI=1S/C16H22BF3O2/c1-13(2,16(18,19)20)11-7-9-12(10-8-11)17-21-14(3,4)15(5,6)22-17/h7-10H,1-6H3 |
InChiKey: | InChIKey=QUUSYEYDUDIVNW-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.