* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IFETROBAN |
CAS: | 143443-90-7 |
English Synonyms: | IFETROBAN |
MDL Number.: | MFCD00902161 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCCCCNC(=O)c1coc(n1)[C@@H]2[C@H]3CC[C@@H]([C@@H]2Cc4ccccc4CCC(=O)O)O3 |
InChi: | InChI=1S/C25H32N2O5/c1-2-3-6-13-26-24(30)19-15-31-25(27-19)23-18(20-10-11-21(23)32-20)14-17-8-5-4-7-16(17)9-12-22(28)29/h4-5,7-8,15,18,20-21,23H,2-3,6,9-14H2,1H3,(H,26,30)(H,28,29)/t18-,20-,21+,23-/m0/s1 |
InChiKey: | InChIKey=BBPRUNPUJIUXSE-DXKRWKNPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.