* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-4-ethanol, 5'-fluoro-2'-methoxy- |
CAS: | 1443305-26-7 |
English Synonyms: | [1,1'-BIPHENYL]-4-ETHANOL, 5'-FLUORO-2'-METHOXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=CC(=C(C1)C1=CC=C(C=C1)CCO)OC |
InChi: | InChI=1S/C15H15FO2/c1-18-15-7-6-13(16)10-14(15)12-4-2-11(3-5-12)8-9-17/h2-7,10,17H,8-9H2,1H3 |
InChiKey: | InChIKey=GTIPKDSZDCEAQT-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.