* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-3-ethanol, 3'-fluoro-4'-methyl- |
CAS: | 1443314-38-2 |
English Synonyms: | [1,1'-BIPHENYL]-3-ETHANOL, 3'-FLUORO-4'-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=C(C=CC1C)C1=CC(=CC=C1)CCO |
InChi: | InChI=1S/C15H15FO/c1-11-5-6-14(10-15(11)16)13-4-2-3-12(9-13)7-8-17/h2-6,9-10,17H,7-8H2,1H3 |
InChiKey: | InChIKey=INJUOSBEDXGYOD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.