* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLISOPRENIN B |
| CAS: | 144376-63-6 |
| English Synonyms: | GLISOPRENIN B |
| MDL Number.: | MFCD01678049 |
| H bond acceptor: | 6 |
| H bond donor: | 5 |
| Smile: | C/C(=C\CC/C(=C/CC/C(=C/CC/C(=C/CO)/C)/C)/C)/CCCC(C)(CCCC(C)(CCCC(C)(CCCC1(CCC(O1)C(C)(C)O)C)O)O)O |
| InChi: | InChI=1S/C45H82O6/c1-36(18-11-19-37(2)21-13-23-39(4)26-35-46)20-12-22-38(3)24-14-27-42(7,48)28-15-29-43(8,49)30-16-31-44(9,50)32-17-33-45(10)34-25-40(51-45)41(5,6)47/h18,21-22,26,40,46-50H,11-17,19-20,23-25,27-35H2,1-10H3/b36-18+,37-21+,38-22+,39-26+ |
| InChiKey: | InChIKey=JVMGRPXMVYGAQN-QYOQUFJESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.