* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROFLEPONIDE |
CAS: | 144459-70-1 |
English Synonyms: | ROFLEPONIDE |
MDL Number.: | MFCD00914391 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCC[C@@H]1O[C@@H]2C[C@H]3[C@@H]4C[C@@H](C5=CC(=O)CC[C@@]5([C@]4([C@H](C[C@@]3([C@@]2(O1)C(=O)CO)C)O)F)C)F |
InChi: | InChI=1S/C25H34F2O6/c1-4-5-21-32-20-10-14-15-9-17(26)16-8-13(29)6-7-22(16,2)24(15,27)18(30)11-23(14,3)25(20,33-21)19(31)12-28/h8,14-15,17-18,20-21,28,30H,4-7,9-12H2,1-3H3/t14-,15-,17-,18-,20+,21+,22-,23-,24-,25+/m0/s1 |
InChiKey: | InChIKey=IXTCZMJQGGONPY-XJAYAHQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.