Molecular Structure:
CAS No.:
144575-47-3
Product Name.:
CCD No.:CCD00151768
Formula:C7 H4 Cl2 N4 O
MolWeight:231.042
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | GEA 3162 |
| CAS： | 144575-47-3 |
| English Synonyms： | GEA 3162 ; 5-AMINO-3-(3,4-DICHLOROPHENYL)-1,2,3,4-OXATRIAZOLIUM CHLORIDE |
| MDL Number.： | MFCD00673027 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1[n+]2nc(on2)[NH-])Cl)Cl |
| InChi： | InChI=1S/C7H4Cl2N4O/c8-5-2-1-4(3-6(5)9)13-11-7(10)14-12-13/h1-3H,(H-,10,11,12) |
| InChiKey： | InChIKey=ZXNZYANFIUGVTK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
