* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Propanone, 1-[(3R)-3-hydroxy-1-pyrrolidinyl]- |
CAS: | 1446002-45-4 |
English Synonyms: | 1-PROPANONE, 1-[(3R)-3-HYDROXY-1-PYRROLIDINYL]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O[C@H]1CN(CC1)C(CC)=O |
InChi: | InChI=1S/C7H13NO2/c1-2-7(10)8-4-3-6(9)5-8/h6,9H,2-5H2,1H3/t6-/m1/s1 |
InChiKey: | InChIKey=DKPZUBJRAYHHQC-ZCFIWIBFSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.