* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GP 1-515 |
CAS: | 144928-48-3 |
English Synonyms: | GP 1-515 ; GP-515 |
MDL Number.: | MFCD00931432 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1nc(c2c(n1)n(nc2Br)[C@H]3[C@@H]([C@@H]([C@H](O3)CN)O)O)N |
InChi: | InChI=1S/C10H13BrN6O3/c11-7-4-8(13)14-2-15-9(4)17(16-7)10-6(19)5(18)3(1-12)20-10/h2-3,5-6,10,18-19H,1,12H2,(H2,13,14,15)/t3-,5-,6-,10-/m1/s1 |
InChiKey: | InChIKey=LTTBFVDMHCIDPM-BHBWVORQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.