* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Hydroxyhept-6-yn-3-one |
CAS: | 1450754-40-1 |
English Synonyms: | 1-HYDROXYHEPT-6-YN-3-ONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OCCC(CCC#C)=O |
InChi: | InChI=1S/C7H10O2/c1-2-3-4-7(9)5-6-8/h1,8H,3-6H2 |
InChiKey: | InChIKey=ZQZAQQAINFKNQT-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.