* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Nonanoic acid, 9-(phenylmethoxy)- |
CAS: | 145122-84-5 |
English Synonyms: | NONANOIC ACID, 9-(PHENYLMETHOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)COCCCCCCCCC(=O)O |
InChi: | InChI=1S/C16H24O3/c17-16(18)12-8-3-1-2-4-9-13-19-14-15-10-6-5-7-11-15/h5-7,10-11H,1-4,8-9,12-14H2,(H,17,18) |
InChiKey: | InChIKey=IZNGEPYWHYNATJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.