* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,8-DIFLUOROQUINOLINE |
| CAS: | 145241-75-4 |
| English Synonyms: | 6,8-DIFLUOROQUINOLINE |
| MDL Number.: | MFCD03662296 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc2cc(cc(c2nc1)F)F |
| InChi: | InChI=1S/C9H5F2N/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h1-5H |
| InChiKey: | InChIKey=TWMLBTXFCAIQRJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.