* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Pentanol, 5-(3-iodophenoxy)- |
CAS: | 1457575-87-9 |
English Synonyms: | 1-PENTANOL, 5-(3-IODOPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | IC=1C=C(OCCCCCO)C=CC1 |
InChi: | InChI=1S/C11H15IO2/c12-10-5-4-6-11(9-10)14-8-3-1-2-7-13/h4-6,9,13H,1-3,7-8H2 |
InChiKey: | InChIKey=VWYYOPHZHCDCMM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.