* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHYL-3,4,5,6-TETRAHYDRO-PYRIDINE 1-OXIDE |
CAS: | 146174-11-0 |
English Synonyms: | 2-ETHYL-3,4,5,6-TETRAHYDRO-PYRIDINE 1-OXIDE |
MDL Number.: | MFCD13178754 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC1=[N+](CCCC1)[O-] |
InChi: | InChI=1S/C7H13NO/c1-2-7-5-3-4-6-8(7)9/h2-6H2,1H3 |
InChiKey: | InChIKey=TTXZIOLZJDDJOD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.