* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Pyrrolidine, 3-(4-bromophenyl)- |
CAS: | 1469974-99-9 |
English Synonyms: | PYRROLIDINE, 3-(4-BROMOPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=C(C=C1)C1CNCC1 |
InChi: | InChI=1S/C10H12BrN/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-4,9,12H,5-7H2 |
InChiKey: | InChIKey=HXTSCISDZDBQEK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.