* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Cyclohexanone, 4-(ethylamino)- |
CAS: | 147009-36-7 |
English Synonyms: | CYCLOHEXANONE, 4-(ETHYLAMINO)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)NC1CCC(CC1)=O |
InChi: | InChI=1S/C8H15NO/c1-2-9-7-3-5-8(10)6-4-7/h7,9H,2-6H2,1H3 |
InChiKey: | InChIKey=IMQUJMKGLFWXHL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.