* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Boc-N-methyl-D-serine |
CAS: | 1481684-50-7 |
English Synonyms: | N-BOC-N-METHYL-D-SERINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N([C@H](CO)C(=O)O)C |
InChi: | InChI=1S/C9H17NO5/c1-9(2,3)15-8(14)10(4)6(5-11)7(12)13/h6,11H,5H2,1-4H3,(H,12,13)/t6-/m1/s1 |
InChiKey: | InChIKey=NJQGIDVCNBZXLG-ZCFIWIBFSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.