* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JMV 390-1 |
CAS: | 148473-36-3 |
English Synonyms: | N-[3-[(HYDROXYAMINO)CARBONYL]-1-OXO 2(R)-BENZYLPROPYL]-ILE-LEU ; JMV 390-1 |
MDL Number.: | MFCD00274000 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)[C@H](Cc1ccccc1)CC(=O)NO |
InChi: | InChI=1S/C23H35N3O6/c1-5-15(4)20(22(29)24-18(23(30)31)11-14(2)3)25-21(28)17(13-19(27)26-32)12-16-9-7-6-8-10-16/h6-10,14-15,17-18,20,32H,5,11-13H2,1-4H3,(H,24,29)(H,25,28)(H,26,27)(H,30,31)/t15-,17+,18-,20-/m0/s1 |
InChiKey: | InChIKey=MWZOULASPWUGJJ-NFBUACBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.