* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Fmoc-N'-methyl-L-asparagine |
CAS: | 149204-93-3 |
English Synonyms: | N-FMOC-N'-METHYL-L-ASPARAGINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OCC1C2=CC=CC=C2C2=CC=CC=C12)N[C@@H](CC(NC)=O)C(=O)O |
InChi: | InChI=1S/C20H20N2O5/c1-21-18(23)10-17(19(24)25)22-20(26)27-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-17H,10-11H2,1H3,(H,21,23)(H,22,26)(H,24,25)/t17-/m0/s1 |
InChiKey: | InChIKey=GCQNMZCRYMMHTM-KRWDZBQOSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.