* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EU 11103 |
| CAS: | 149396-90-7 |
| English Synonyms: | EU 11103 |
| MDL Number.: | MFCD02874262 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c(c(c1)C(C)(C)C)O)C(c2ncc(n2C)[N+](=O)[O-])O |
| InChi: | InChI=1S/C16H21N3O4/c1-9-6-10(13(20)11(7-9)16(2,3)4)14(21)15-17-8-12(18(15)5)19(22)23/h6-8,14,20-21H,1-5H3 |
| InChiKey: | InChIKey=GFZQMNIRXLORBU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.