* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-DIBROMOFURAN-2(5H)-ONE |
CAS: | 149418-41-7 |
English Synonyms: | 3,4-DIBROMO-2(5H)-FURANONE ; 3,4-DIBROMOFURAN-2(5H)-ONE ; 3,4-DIBROMO-2,5-DIHYDROFURAN-2-ONE |
MDL Number.: | MFCD02752391 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1C(=C(C(=O)O1)Br)Br |
InChi: | InChI=1S/C4H2Br2O2/c5-2-1-8-4(7)3(2)6/h1H2 |
InChiKey: | InChIKey=UBAYSWXSWXORAN-UHFFFAOYSA-N |
Property |
|
Melting Point: | 90-94 DEG C |
Comments: | WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H302-H317-H319 |
Precautionary statements: | P280-P305 + P351 + P338 |
hazard symbol: | Xn |
Risk Code: | R:22-36 |
Safe Code: | S:26 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.