* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Cyclopropanamine, 1-pentyl- |
CAS: | 1495755-66-2 |
English Synonyms: | CYCLOPROPANAMINE, 1-PENTYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CCCC)C1(CC1)N |
InChi: | InChI=1S/C8H17N/c1-2-3-4-5-8(9)6-7-8/h2-7,9H2,1H3 |
InChiKey: | InChIKey=VJIJQMBCGHQQBG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.