* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,3,8-TETRACHLORONAPHTHALENE |
CAS: | 149864-81-3 |
English Synonyms: | 1,2,3,8-TETRACHLORONAPHTHALENE |
MDL Number.: | MFCD03095680 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1cc2cc(c(c(c2c(c1)Cl)Cl)Cl)Cl |
InChi: | InChI=1S/C10H4Cl4/c11-6-3-1-2-5-4-7(12)9(13)10(14)8(5)6/h1-4H |
InChiKey: | InChIKey=UVMHXYSILPJXPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.