* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Azetidinemethanol, 1-methyl- |
CAS: | 1499172-23-4 |
English Synonyms: | 3-AZETIDINEMETHANOL, 1-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN1CC(C1)CO |
InChi: | InChI=1S/C5H11NO/c1-6-2-5(3-6)4-7/h5,7H,2-4H2,1H3 |
InChiKey: | InChIKey=MFYXNTFIFHINFW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.