* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,3,4,5,6-PENTACHLOROSTYRENE |
CAS: | 14992-81-5 |
English Synonyms: | 1,2,3,4,5-PENTACHLORO-6-ETHENYLBENZENE ; 2,3,4,5,6-PENTACHLOROSTYRENE |
MDL Number.: | MFCD02752265 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C=Cc1c(c(c(c(c1Cl)Cl)Cl)Cl)Cl |
InChi: | InChI=1S/C8H3Cl5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
InChiKey: | InChIKey=AGOFZVAQMFVJEQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.