* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ELISARTAN |
CAS: | 158682-68-9 ;149968-26-3 |
English Synonyms: | ELISARTAN |
MDL Number.: | MFCD00868916 |
H bond acceptor: | 11 |
H bond donor: | 2 |
Smile: | CCCCc1nc(c(n1C(C)(c2ccc(cc2)Cc3ccccc3c4[nH]nnn4)OC(=O)OCC)C(=O)O)Cl |
InChi: | InChI=1S/C27H29ClN6O5/c1-4-6-11-21-29-23(28)22(25(35)36)34(21)27(3,39-26(37)38-5-2)19-14-12-17(13-15-19)16-18-9-7-8-10-20(18)24-30-32-33-31-24/h7-10,12-15H,4-6,11,16H2,1-3H3,(H,35,36)(H,30,31,32,33) |
InChiKey: | InChIKey=AURIMXYPFAHNPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.