Molecular Structure:
CAS No.:
102608-53-7
;7541-49-3
;150-86-7
Product Name.:
CCD No.:CCD00075168
Formula:C20 H40 O
MolWeight:296.535
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(24)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(7)
|
|
| Product Name： | PHYTOL |
| CAS： | 102608-53-7 ;7541-49-3 ;150-86-7 |
| English Synonyms： | 3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL ; TRANS-PHYTOL ; [R-[R*,R*-(E)]]-3,7,11,15-TETRAMETHYL-2-HEXADECEN-1-OL ; PHYTOL |
| MDL Number.： | MFCD00151280 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC/C(=C/CO)/C |
| InChi： | InChI=1S/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChiKey： | InChIKey=BOTWFXYSPFMFNR-PYDDKJGSSA-N |
|
|
| Boiling Point： | DENSITY: 0.85 |
| Physical Property： | REFRACTIVE INDEX: 1.465 (20 DEG C) RHO(25 DEG C)0.850G/ML |
| Specification： | GUARANTEED REAGENT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
