* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-2-ethanol, 4'-hydroxy- |
CAS: | 1501869-19-7 |
English Synonyms: | [1,1'-BIPHENYL]-2-ETHANOL, 4'-HYDROXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OC1=CC=C(C=C1)C=1C(=CC=CC1)CCO |
InChi: | InChI=1S/C14H14O2/c15-10-9-11-3-1-2-4-14(11)12-5-7-13(16)8-6-12/h1-8,15-16H,9-10H2 |
InChiKey: | InChIKey=WWVBTMRBXDXSKF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.