* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3,4,6,7,9,9B-HEPTAAZAPHENALENE-2,5,8-TRIAMINE |
| CAS: | 1502-47-2 |
| English Synonyms: | 1,3,4,6,7,9,9B-HEPTAAZAPHENALENE-2,5,8-TRIAMINE |
| MDL Number.: | MFCD00767872 |
| H bond acceptor: | 10 |
| H bond donor: | 3 |
| Smile: | C1(=NC2=NC(=NC3=NC(=NC(=N1)N23)N)N)N |
| InChi: | InChI=1S/C6H6N10/c7-1-10-4-12-2(8)14-6-15-3(9)13-5(11-1)16(4)6/h(H6,7,8,9,10,11,12,13,14,15) |
| InChiKey: | InChIKey=YSRVJVDFHZYRPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.